Products Categories
| CAS No.: | 88441-15-0 |
|---|---|
| Name: | 2C-C |
| Molecular Structure: | |
|
|
|
| Formula: | C10H15Cl2NO2 |
| Molecular Weight: | 252.14 |
| Synonyms: | Benzeneethanamine,4-chloro-2,5-dimethoxy-, hydrochloride (9CI);4-Chloro-2,5-dimethoxyphenethylaminehydrochloride; |
| Melting Point: | 213-216°C |
| Flash Point: | 9℃ |
| Hazard Symbols: | F,T |
| Risk Codes: | 11-23/24/25-39/23/24/25 |
| Safety: | 7-16-36/37-45 |
| PSA: | 44.48000 |
| LogP: | 3.36070 |
- 958254-66-51H-Imidazo[4,5-b]pyridine-2-carboxaldehyde, 1-methyl-, hydrochloride
- 99170-93-1N-Methyl-2-oxazolamine
- 914458-26-7[5-(2-fluorophenyl)-1-pentyl-1H-pyrrol-3-yl]-1-naphthalenyl-Methanone
- 894852-01-87-BROMO-2,2-DIMETHYL-2H-PYRIDO[3,2-B][1,4]OXAZIN-3(4H)-ONE
- 90221-55-92-bromo-5-methylbenzaldehyde
- 885590-99-82,3-DIFLUORO-4-IODOBENZALDEHYDE
- 97730-31-9(S)-4'-(2-Methylbutyl)Biphenyl-4-Carbonitrile
- 926293-55-26-Bromo-2-methylpyridine-3-carboxaldehyde
- 911112-05-55-Iodo-3-(trifluoromethyl)-2-pyridinamine
- 886364-50-71-(5-Bromo-2-pyridinyl)-2,2,2-trifluoroethanone
This product is a nationally controlled contraband, and the Lookchem platform doesn't provide relevant sales information.
Specification
The 2,5-Dimethoxy-4-chlorophenethylamine hydrochloride, with the CAS registry number 88441-15-0, is also known as 4-Chloro-2,5-dimethoxybenzeneethanamine hydrochloride. It belongs to the product categories of Amines; Aromatics; Intermediates & Fine Chemicals; Pharmaceuticals. This chemical's molecular formula is C10H15Cl2NO2 and molecular weight is 252.1376. Its IUPAC name is called 2-(4-chloro-2,5-dimethoxyphenyl)ethanamine hydrochloride. This chemical can be used as a phenethylamine derivative and 2C-series designer drugs.
Physical properties of 2,5-Dimethoxy-4-chlorophenethylamine hydrochloride: (1)H-Bond Donor: 2; (2)H-Bond Acceptor: 3; (3)Rotatable Bond Count: 4; (4)Exact Mass: 251.047984; (5)MonoIsotopic Mass: 251.047984; (6)Topological Polar Surface Area: 44.5; (7)Heavy Atom Count: 15; (8)Formal Charge: 0; (9)Complexity: 168; (10)Covalently-Bonded Unit Count: 2.
You can still convert the following datas into molecular structure:
(1)Canonical SMILES: COC1=CC(=C(C=C1CCN)OC)Cl.Cl
(2)InChI: InChI=1S/C10H14ClNO2.ClH/c1-13-9-6-8(11)10(14-2)5-7(9)3-4-12;/h5-6H,3-4,12H2,1-2H3;1H
(3)InChIKey: BKHKVQPFRTVWJY-UHFFFAOYSA-N