Products Categories
CAS No.: | 89232-76-8 |
---|---|
Name: | L-SERINE (2-13C) |
Molecular Structure: | |
Formula: | C213CH7NO3 |
Molecular Weight: | 106.10 |
Synonyms: | L-[2-13C]Serine; |
Density: | 1.415 g/cm3 |
Melting Point: | 222 °C (dec.)(lit.) |
PSA: | 83.55000 |
LogP: | -0.90910 |
This chemical is called L-(1-13C)serine, and it's also named as L-Serine-2-13C . With the molecular formula of C213CH7NO3, its molecular weight is 106.10. The CAS registry number of this chemical is 89232-76-8. Additionally, its product categories are Amino Acids 13C, 2H, 15N; Alphabetical Listings; Amino Acids; Q-S; Stable Isotopes.
Other characteristics of the L-(1-13C)serine can be summarised as followings: (1)Index of Refraction: 1.519; (2)Molar Refractivity: 22.54 cm3; (3)Molar Volume: 74.2 cm3; (4)Polarizability: 8.93×10-24cm3; (5)Surface Tension: 72.2 dyne/cm; (6)Density: 1.415 g/cm3.
You can still convert the following datas into molecular structure:
1.SMILES: C(C(C(=O)O)N)O
2.InChI: InChI=1/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1/i3+1
3.InChIKey: MTCFGRXMJLQNBG-NSQKCYGPFA