Products Categories
CAS No.: | 90717-16-1 |
---|---|
Name: | 1-[(2-Chlorophenyl)-N-(methylimino)methyl]cyclopentanol hydrochloride |
Molecular Structure: | |
|
|
Formula: | C13H16ClNO.HCl |
Molecular Weight: | 274.19 |
Synonyms: | Cyclopentanol,1-[(2-chlorophenyl)(methylimino)methyl]-, hydrochloride (9CI);2-Chlorophenyl-1-hydroxy-1-cyclopentyl N-methyl ketimine hydrochloride;1-[(2-Chlorophenyl)-N-(methylimino)methyl]cyclopentanol hydrochloride; |
EINECS: | 274-186-8 |
Melting Point: | 169-174 °C |
PSA: | 32.59000 |
LogP: | 3.86600 |
The CAS register number of 1-[(2-Chlorophenyl)-N-(methylimino)methyl]cyclopentanol hydrochloride is 90717-16-1. It also can be called as 2-Chlorophenyl-1-hydroxy-1-cyclopentyl N-methyl ketimine hydrochloride and the systematic name about this chemical is 1-[(Z)-C-(2-chlorophenyl)-N-methyl-carbonimidoyl]cyclopentanol hydrochloride. The molecular formula about this chemical is C13H16ClNO.HCl;C13H17Cl2NO and the molecular weight is 274.19.
You can still convert the following datas into molecular structure:
(1)SMILES:C/N=C(\c1ccccc1Cl)/C2(CCCC2)O.Cl;
(2)Std. InChI:InChI=1S/C13H16ClNO.ClH/c1-15-12(13(16)8-4-5-9-13)10-6-2-3-7-11(10)14;/h2-3,6-7,16H,4-5,8-9H2,1H3;1H/b15-12+;;
(3)Std. InChIKey:CKDXSVLVPYBGPG-JRUHLWALSA-N.