Products Categories
| CAS No.: | 91346-98-4 |
|---|---|
| Name: | 1,10-Dinitrodecane |
| Molecular Structure: | |
|
|
|
| Formula: | C10H20N2O4 |
| Molecular Weight: | 232.28 |
| Density: | 1.059 g/cm3 |
| Boiling Point: | 361.4 °C at 760 mmHg |
| Flash Point: | 161.3 °C |
This chemical is called 1,10-Dinitrodecane, and its CAS registry number is 91346-98-4. With the molecular formula of C10H20N2O4, its molecular weight is 232.28.
Other characteristics of the 1,10-Dinitrodecane can be summarised as followings: (1)ACD/LogP: 3.11; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 6; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 11; (6)Polar Surface Area: 91.64 Å2; (7)Index of Refraction: 1.463; (8)Molar Refractivity: 60.42 cm3; (9)Molar Volume: 219.1 cm3; (10)Polarizability: 23.95×10-24cm3; (11)Surface Tension: 38.8 dyne/cm; (12)Density: 1.059 g/cm3; (13)Flash Point: 161.3 °C; (14)Enthalpy of Vaporization: 60.72 kJ/mol; (15)Boiling Point: 361.4 °C at 760 mmHg; (16)Vapour Pressure: 2.07E-05 mmHg at 25°C.
You can still convert the following datas into molecular structure:
1.SMILES: [O-][N+](=O)CCCCCCCCCC[N+]([O-])=O
2.InChI: InChI=1/C10H20N2O4/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16/h1-10H2
3.InChIKey: LTVQSKUCEODYDB-UHFFFAOYAB