1013-18-9 Usage
Description
2-Chloro-1-(2-methyl-2,3-dihydro-indol-1-yl)-ethanone is a chlorinated ketone chemical compound with the molecular formula C11H12ClNO. It features a substituted indole ring, which contributes to its unique chemical properties and reactivity.
Uses
Used in Pharmaceutical Synthesis:
2-Chloro-1-(2-methyl-2,3-dihydro-indol-1-yl)-ethanone is utilized as a key intermediate in the synthesis of various pharmaceuticals and organic compounds. Its functional group plays a crucial role in the formation of new chemical entities with potential therapeutic applications.
Used as a Reagent in Chemical Reactions:
In the field of organic chemistry, 2-Chloro-1-(2-methyl-2,3-dihydro-indol-1-yl)-ethanone serves as a valuable reagent. It is employed to facilitate chemical reactions, particularly those involving the formation of new carbon-carbon bonds, which are essential for creating complex organic molecules.
Used in Medicinal Chemistry and Drug Development:
2-Chloro-1-(2-methyl-2,3-dihydro-indol-1-yl)-ethanone also holds promise in medicinal chemistry and drug development. Its unique structure and reactivity make it a candidate for the design and synthesis of novel drug molecules, potentially leading to the discovery of new treatments for various diseases and medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 1013-18-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,1 and 3 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 1013-18:
(6*1)+(5*0)+(4*1)+(3*3)+(2*1)+(1*8)=29
29 % 10 = 9
So 1013-18-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H12ClNO/c1-8-6-9-4-2-3-5-10(9)13(8)11(14)7-12/h2-5,8H,6-7H2,1H3
1013-18-9Relevant articles and documents
Indoline and piperazine containing derivatives as a novel class of mixed D2/D4 receptor antagonists. Part 1: Identification and structure-activity relationships
Zhao, He,Thurkauf, Andrew,He, Xiaoshu,Hodgetts, Kevin,Zhang, Xiaoyan,Rachwal, Stanislaw,Kover, Renata X.,Hutchison, Alan,Peterson, John,Kieltyka, Andrzej,Brodbeck, Robbin,Primus, Renee,Wasley, Jan W.F.
, p. 3105 - 3109 (2007/10/03)
Optimization of the lead compound 2-[-4-(4-chloro-benzyl)-piperazin-1-yl]-1-(2,3-dihydro-indol-1-yl)-ethanone 1 by systematic structure-activity relation (SAR) studies lead to two potent compounds 2-[-4-(4-chloro-benzyl)-piperazin-1-yl]-1-(2-methy-2,3-dihydro-indol-1-yl)- ethanone 2n and 2-[-4-(4-chloro-benzyl)-piperazin-1-yl]-1-(2-methy-2,3-dihydro-indol-1-yl)- ethanone 7b. Their related synthesis was also reported.