10138-79-1 Usage
Description
TRIS(2-CHLOROETHOXY)SILANE, with the chemical formula C6H15Cl3O3Si, is a clear, colorless liquid that serves as a versatile coupling agent in various industrial applications. Its unique properties, such as enhancing adhesion and durability, make it a valuable component in the production of adhesives, sealants, and coatings. Additionally, it plays a crucial role in the manufacturing of silicone-based polymers and resins, improving the weather and chemical resistance of the final products.
Uses
Used in Adhesives, Sealants, and Coatings Industry:
TRIS(2-CHLOROETHOXY)SILANE is used as a coupling agent for improving the adhesion and durability of adhesives, sealants, and coatings. Its ability to form strong bonds between different materials contributes to the enhanced performance and longevity of these products.
Used in Silicone-based Polymers and Resins Industry:
TRIS(2-CHLOROETHOXY)SILANE is utilized as a key component in the manufacturing of silicone-based polymers and resins. It plays a significant role in enhancing the weather and chemical resistance of the final products, ensuring their stability and performance in various applications.
Safety Precautions:
Check Digit Verification of cas no
The CAS Registry Mumber 10138-79-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,1,3 and 8 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 10138-79:
(7*1)+(6*0)+(5*1)+(4*3)+(3*8)+(2*7)+(1*9)=71
71 % 10 = 1
So 10138-79-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H12Cl3O3Si/c7-1-4-10-13(11-5-2-8)12-6-3-9/h1-6H2