102-33-0 Usage
Uses
Used in Pharmaceutical Industry:
N-(3-amino-4-hydroxyphenyl)acetamide is used as a synthetic intermediate for the development of pharmaceuticals, leveraging its unique molecular structure to create compounds with potential therapeutic applications. Its presence in the synthesis process can contribute to the creation of new drugs with specific targeting or efficacy profiles.
Used in Chemical Research:
In the field of chemical research, N-(3-amino-4-hydroxyphenyl)acetamide is utilized as a model compound to study the properties and reactions of similar acetamide derivatives. This helps in understanding the reactivity, stability, and potential applications of related compounds in various chemical processes.
Used in Organic Synthesis:
N-(3-amino-4-hydroxyphenyl)acetamide is employed as a key component in organic synthesis, where it can be used to construct more complex molecules with specific functions. Its versatility in forming different types of chemical bonds makes it valuable in the synthesis of a wide range of organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 102-33-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,0 and 2 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 102-33:
(5*1)+(4*0)+(3*2)+(2*3)+(1*3)=20
20 % 10 = 0
So 102-33-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O2/c1-5(11)10-6-2-3-8(12)7(9)4-6/h2-4,12H,9H2,1H3,(H,10,11)
