10242-15-6 Usage
Description
6-NITRO-2-OXO-2H-CHROMENE-3-CARBOXYLIC ACID is a chemical compound characterized by a molecular formula of C10H5NO7. It is an organic compound that features a nitro group and a chromene ring structure, which contributes to its potential applications in various industries.
Uses
Used in Pharmaceutical Industry:
6-NITRO-2-OXO-2H-CHROMENE-3-CARBOXYLIC ACID is used as a chemical intermediate for the synthesis of pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs, potentially contributing to advancements in medicine.
Used in Organic Compounds Synthesis:
In the field of organic chemistry, 6-NITRO-2-OXO-2H-CHROMENE-3-CARBOXYLIC ACID serves as an intermediate for synthesizing other organic compounds. Its presence in these reactions can lead to the creation of novel molecules with diverse applications.
Used in Agricultural Industry:
6-NITRO-2-OXO-2H-CHROMENE-3-CARBOXYLIC ACID may have potential applications in the agricultural sector. Its use could be related to the development of new agrochemicals, such as pesticides or fertilizers, that can improve crop yield and protection.
Used in Manufacturing Industry:
6-NITRO-2-OXO-2H-CHROMENE-3-CARBOXYLIC ACID may also find use in the manufacturing industry, where it could be employed in the production of various industrial products. Its versatility in chemical reactions may contribute to the development of new materials and processes.
Safety Precautions:
As with any chemical, it is crucial to follow proper handling and safety precautions when working with 6-NITRO-2-OXO-2H-CHROMENE-3-CARBOXYLIC ACID. This includes understanding its potential hazards and implementing measures to mitigate any risks associated with its use.
Check Digit Verification of cas no
The CAS Registry Mumber 10242-15-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,4 and 2 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 10242-15:
(7*1)+(6*0)+(5*2)+(4*4)+(3*2)+(2*1)+(1*5)=46
46 % 10 = 6
So 10242-15-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H5NO6/c12-9(13)7-4-5-3-6(11(15)16)1-2-8(5)17-10(7)14/h1-4H,(H,12,13)