102432-03-1 Usage
Uses
Used in Pharmaceutical Industry:
4-(1H-IMIDAZOL-1-YLMETHYL)BENZALDEHYDE is used as an intermediate compound for the synthesis of various pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs with potential therapeutic applications.
Used in Chemical Synthesis:
4-(1H-IMIDAZOL-1-YLMETHYL)BENZALDEHYDE is used as a building block in the synthesis of other complex organic compounds. Its presence in the molecular structure can contribute to the formation of new compounds with diverse properties and potential applications in various fields.
Used in Research and Development:
4-(1H-IMIDAZOL-1-YLMETHYL)BENZALDEHYDE is used as a research compound in academic and industrial laboratories. Its properties and reactivity are studied to understand its potential applications and to develop new methods for its synthesis and use in various chemical processes.
Note: The exact applications and uses of 4-(1H-IMIDAZOL-1-YLMETHYL)BENZALDEHYDE may vary based on the grade and purity of the compound, as well as the specific requirements of the industry or research field in which it is being used.
Check Digit Verification of cas no
The CAS Registry Mumber 102432-03-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,2,4,3 and 2 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 102432-03:
(8*1)+(7*0)+(6*2)+(5*4)+(4*3)+(3*2)+(2*0)+(1*3)=61
61 % 10 = 1
So 102432-03-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O/c14-8-11-3-1-10(2-4-11)7-13-6-5-12-9-13/h1-6,8-9H,7H2
102432-03-1Relevant academic research and scientific papers
1,3-dipolar compound bearing an imidazole functional group
-
, (2019/02/20)
In a 1,3-dipolar compound of formula Q-A-B, Q comprises a dipole containing at least and preferably one nitrogen atom, A, which is preferably divalent, is an atom or a group of atoms connecting Q to B, and B comprises an imidazole ring. An unsaturated polymer modified by grafting the 1,3-dipolar compound is also disclosed.
Imidazolyl compounds and their use as medicaments
-
, (2008/06/13)
The present invention relates to new ortho-, meta- and para-substituted imidazolylmethylstyrenes of the formula I STR1 and to a process for their preparation. The compounds according to the invention are distinguished by having a specific inhibitory effec
