10263-67-9 Usage
Uses
Used in Pharmaceutical Synthesis:
2-CHLORO-N-(3-ISOPROPOXYPROPYL)ACETAMIDE is used as an intermediate in the synthesis of various pharmaceuticals, contributing to the development of new medications and therapeutic agents.
Used in Organic Compounds Synthesis:
2-CHLORO-N-(3-ISOPROPOXYPROPYL)ACETAMIDE serves as an intermediate in the synthesis of other organic compounds, playing a crucial role in the creation of a wide range of chemical products.
Used in Organic Chemical Reactions:
2-CHLORO-N-(3-ISOPROPOXYPROPYL)ACETAMIDE functions as a reagent in organic chemical reactions, facilitating specific transformations and processes in organic chemistry.
Used in Medicinal Chemistry and Drug Development:
Due to its structural properties and functional groups, 2-CHLORO-N-(3-ISOPROPOXYPROPYL)ACETAMIDE may have potential applications in medicinal chemistry and drug development, potentially leading to the discovery of new therapeutic agents and treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 10263-67-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,6 and 3 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 10263-67:
(7*1)+(6*0)+(5*2)+(4*6)+(3*3)+(2*6)+(1*7)=69
69 % 10 = 9
So 10263-67-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H16ClNO2/c1-7(2)12-5-3-4-10-8(11)6-9/h7H,3-6H2,1-2H3,(H,10,11)
