107485-64-3 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloro-6-nitrobenzamide is used as a key intermediate in the synthesis of various pharmaceutical compounds for its reactivity and ability to contribute to the formation of desired medicinal agents.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Chloro-6-nitrobenzamide serves as a precursor in the production of agrochemicals, playing a crucial role in the development of substances that protect crops and enhance agricultural productivity.
Used in Dye Production:
2-Chloro-6-nitrobenzamide is used as an intermediate in the manufacturing process of dyes, contributing to the creation of a wide range of colorants used in various industries.
Used in Organic Compounds Synthesis:
2-CHLORO-6-NITROBENZAMIDE is also utilized in the synthesis of other organic compounds, showcasing its versatility and importance in organic chemistry for creating a diverse array of products.
Check Digit Verification of cas no
The CAS Registry Mumber 107485-64-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,7,4,8 and 5 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 107485-64:
(8*1)+(7*0)+(6*7)+(5*4)+(4*8)+(3*5)+(2*6)+(1*4)=133
133 % 10 = 3
So 107485-64-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H5ClN2O3/c8-4-2-1-3-5(10(12)13)6(4)7(9)11/h1-3H,(H2,9,11)
