1090-74-0 Usage
Uses
Used in Pharmaceutical Industry:
2-(4-methoxyphenyl)-2H-chromene-5,7-diol is used as a therapeutic agent for its potential applications in treating cardiovascular disease, cancer, and neurodegenerative disorders. Its antioxidant and anti-inflammatory properties contribute to its potential efficacy in these conditions.
Used in Medicinal Chemistry Research:
2-(4-methoxyphenyl)-2H-chromene-5,7-diol is used as a target for further research and development in the field of medicinal chemistry due to its unique structure and potential therapeutic properties. This research aims to explore its mechanisms of action and optimize its use in various medical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1090-74-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,9 and 0 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1090-74:
(6*1)+(5*0)+(4*9)+(3*0)+(2*7)+(1*4)=60
60 % 10 = 0
So 1090-74-0 is a valid CAS Registry Number.
InChI:InChI=1/C16H14O4/c1-19-12-4-2-10(3-5-12)15-7-6-13-14(18)8-11(17)9-16(13)20-15/h2-9,15,17-18H,1H3
1090-74-0Relevant academic research and scientific papers
Quantitative Measurement of Proton Dissociation and Tautomeric Constants of Apigeninidin
Costantino, Luca,Rastelli, Giulio,Rossi, Maria C.,Albasini, Albano
, p. 227 - 234 (2007/10/02)
Depending on the pH of the medium, the anthocyanidin apigeninidin may deprotonate, leading to the formation of three tautomeric neutral and anionic forms.In order to determine the relative percent
