111787-89-4 Usage
Uses
Used in Pharmaceutical Industry:
5-(4-CHLOROPHENYL)-2-METHYL-3-FUROIC ACID is used as a key intermediate in the synthesis of pharmaceutical compounds due to its unique chemical structure and potential biological activities. Its anti-inflammatory and anti-ulcer properties make it a promising candidate for the development of new drugs targeting these conditions.
Used in Organic Synthesis:
In the field of organic synthesis, 5-(4-CHLOROPHENYL)-2-METHYL-3-FUROIC ACID serves as a valuable building block for the creation of various organic compounds. Its reactivity and functional groups allow for further chemical modifications, leading to the production of a wide range of specialized chemicals and materials.
Used in Biological Research:
5-(4-CHLOROPHENYL)-2-METHYL-3-FUROIC ACID is utilized in biological research as a tool to study the mechanisms of inflammation and ulceration. Its potential biological activities provide insights into the development of novel therapeutic approaches for treating these conditions.
Used in Chemical Industry:
In the chemical industry, 5-(4-CHLOROPHENYL)-2-METHYL-3-FUROIC ACID finds applications in the production of various chemical products. Its versatility and reactivity contribute to the synthesis of specialty chemicals, dyes, and other industrially relevant compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 111787-89-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,1,7,8 and 7 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 111787-89:
(8*1)+(7*1)+(6*1)+(5*7)+(4*8)+(3*7)+(2*8)+(1*9)=134
134 % 10 = 4
So 111787-89-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H9ClO3/c1-7-10(12(14)15)6-11(16-7)8-2-4-9(13)5-3-8/h2-6H,1H3,(H,14,15)
