112905-95-0 Usage
Uses
Used in Pharmaceutical Industry:
1-(CHLOROMETHYL)CYCLOHEXANECARBONITRILE is used as a chemical intermediate for the synthesis of various pharmaceuticals, contributing to the development of new drugs and medicines. Its unique properties allow it to be a key component in creating complex molecular structures necessary for effective pharmaceutical compounds.
Used in Agrochemical Industry:
In the agrochemical sector, 1-(CHLOROMETHYL)CYCLOHEXANECARBONITRILE serves as an intermediate in the production of agrochemicals, which are essential for enhancing crop protection and improving agricultural yields. Its role in this industry is vital for the synthesis of compounds that help in pest control and other agricultural applications.
Used in Polymer Production:
1-(CHLOROMETHYL)CYCLOHEXANECARBONITRILE is utilized as a chemical intermediate in the manufacturing process of polymers. Its contribution to polymer chemistry aids in the development of materials with specific properties required for various applications, including plastics, resins, and other synthetic materials.
Used in Dye and Pigment Industry:
1-(CHLOROMETHYL)CYCLOHEXANECARBONITRILE is also used as a chemical intermediate in the production of dyes and pigments. Its involvement in the synthesis of colorants is crucial for the creation of vibrant and stable colors used in textiles, paints, inks, and other coloring applications.
Check Digit Verification of cas no
The CAS Registry Mumber 112905-95-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,2,9,0 and 5 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 112905-95:
(8*1)+(7*1)+(6*2)+(5*9)+(4*0)+(3*5)+(2*9)+(1*5)=110
110 % 10 = 0
So 112905-95-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H12ClN/c9-6-8(7-10)4-2-1-3-5-8/h1-6H2
112905-95-0Relevant academic research and scientific papers
Synthesis of 2,2-Dialkyl-3-halopropanenitriles from 2,2-Dialkylethanenitriles and Dihalomethanes
Cliffe, Ian A.,Todd, Richard S.,White, Alan C.
, p. 1757 - 1767 (2007/10/02)
A simple high-yielding synthesis of 2,2-dialkyl-3-halopropanenitriles is described which involves the alkylation of 2,2-dialkylethanenitriles with bromochloromethane.
Harmful:;
