1132610-44-6 Usage
General Description
Ethanone, 1-(5-fluoro-6-Methyl-2-pyridinyl)-2-(6-quinoxalinyl)- is a chemical compound with a complex and specific structure. It contains a ketone group (ethanone) attached to a 5-fluoro-6-methyl-2-pyridinyl group and a 6-quinoxalinyl group. Ethanone, 1-(5-fluoro-6-Methyl-2-pyridinyl)-2-(6-quinoxalinyl)- may have various potential applications in pharmaceuticals, agrochemicals, or materials science, but its exact uses and properties would depend on further study and testing. The specific structure and arrangement of its constituent parts give it potential for specific interactions and activities in various chemical and biological systems.
Check Digit Verification of cas no
The CAS Registry Mumber 1132610-44-6 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,1,3,2,6,1 and 0 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1132610-44:
(9*1)+(8*1)+(7*3)+(6*2)+(5*6)+(4*1)+(3*0)+(2*4)+(1*4)=96
96 % 10 = 6
So 1132610-44-6 is a valid CAS Registry Number.
InChI:InChI=1S/C16H12FN3O/c1-10-12(17)3-5-14(20-10)16(21)9-11-2-4-13-15(8-11)19-7-6-18-13/h2-8H,9H2,1H3