113544-59-5 Usage
Uses
Used in Pharmaceutical Industry:
2,3,4,6-TETRA-O-BENZOYL-D-MANNOPYRANOSE is used as a key intermediate in the synthesis of N-acetylglucosamine-bearing oleanolic acid saponins, which exhibit anti-cancer properties towards human leukemia and colorectal cancer cells. Its involvement in the creation of these bioactive compounds makes it a valuable asset in the development of novel cancer treatments.
Used in Chemical Synthesis:
2,3,4,6-TETRA-O-BENZOYL-D-MANNOPYRANOSE is used as a chelating agent for chelation-assisted glycosylation, a technique employed in the synthesis of complex carbohydrate structures. This application is crucial in the development of new compounds with potential applications in various industries, including pharmaceuticals, materials science, and biotechnology.
Check Digit Verification of cas no
The CAS Registry Mumber 113544-59-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,3,5,4 and 4 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 113544-59:
(8*1)+(7*1)+(6*3)+(5*5)+(4*4)+(3*4)+(2*5)+(1*9)=105
105 % 10 = 5
So 113544-59-5 is a valid CAS Registry Number.
InChI:InChI=1/C34H28O10/c35-30(22-13-5-1-6-14-22)40-21-26-27(42-31(36)23-15-7-2-8-16-23)28(43-32(37)24-17-9-3-10-18-24)29(34(39)41-26)44-33(38)25-19-11-4-12-20-25/h1-20,26-29,34,39H,21H2/t26-,27-,28+,29+,34u/m1/s1