1152-31-4 Usage
Uses
Used in Medicinal Chemistry and Drug Development:
(2Z)-2-(pyridine-4-carbonylhydrazinylidene)pentanedioic acid is used as a building block for the development of new pharmaceutical compounds. Its unique structure, which includes a pyridine ring and a hydrazine group, may contribute to the design of novel drugs with specific therapeutic properties.
Used in Synthesis of Other Organic Molecules:
(2Z)-2-(pyridine-4-carbonylhydrazinylidene)pentanedioic acid is used as a synthetic intermediate for the preparation of other organic molecules. Its reactivity and functional groups can be utilized in various chemical reactions to produce a range of organic compounds with different applications.
Used in Coordination Chemistry:
(2Z)-2-(pyridine-4-carbonylhydrazinylidene)pentanedioic acid is used as a chelating agent in coordination chemistry. Its ability to form complexes with metal ions can be exploited for the development of new coordination compounds with potential applications in various fields, such as catalysis, materials science, and supramolecular chemistry.
Further research is needed to fully understand the potential uses and properties of (2Z)-2-(pyridine-4-carbonylhydrazinylidene)pentanedioic acid and to explore its applications in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 1152-31-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,5 and 2 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 1152-31:
(6*1)+(5*1)+(4*5)+(3*2)+(2*3)+(1*1)=44
44 % 10 = 4
So 1152-31-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H11N3O5/c15-9(16)2-1-8(11(18)19)13-14-10(17)7-3-5-12-6-4-7/h3-6H,1-2H2,(H,14,17)(H,15,16)(H,18,19)/b13-8+
