116529-60-3 Usage
Uses
Used in Pharmaceutical Industry:
2-Bromo-3,5-dinitrobenzoic acid is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure and reactivity make it a valuable component in the development of new drugs and medicinal compounds.
Used in Dye Industry:
In the dye industry, 2-Bromo-3,5-dinitrobenzoic acid is utilized as a precursor in the production of various dyes. Its chemical properties contribute to the color and stability of the resulting dyes, making it an essential component in dye manufacturing processes.
Used in Organic Synthesis:
2-Bromo-3,5-dinitrobenzoic acid is employed as a versatile chemical intermediate in organic synthesis. Its reactivity allows for the formation of various organic compounds, making it a valuable building block in the synthesis of complex molecules.
Used as a Reagent in Environmental Analysis:
2-Bromo-3,5-dinitrobenzoic acid is used as a reagent for the determination of phenols in water. Its strong acid properties enable the detection and quantification of phenolic compounds, which are important environmental pollutants.
Used in Biological and Environmental Research:
Due to its potential applications in biological and environmental research, 2-Bromo-3,5-dinitrobenzoic acid is utilized in various studies to understand its interactions with biological systems and its potential impact on the environment. This research can lead to the development of new applications and a better understanding of its properties.
Check Digit Verification of cas no
The CAS Registry Mumber 116529-60-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,6,5,2 and 9 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 116529-60:
(8*1)+(7*1)+(6*6)+(5*5)+(4*2)+(3*9)+(2*6)+(1*0)=123
123 % 10 = 3
So 116529-60-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H3BrN2O6/c8-6-4(7(11)12)1-3(9(13)14)2-5(6)10(15)16/h1-2H,(H,11,12)
