1186-98-7 Usage
Uses
Used in Pharmaceutical Industry:
DIMETHYL 2,3-DIBROMO-1,4-BUTANEDIOATE is used as a reagent in the synthesis of various pharmaceutical compounds. Its unique structure and properties make it a valuable component in the development of new drugs and medicines.
Used in Agrochemical Industry:
In the agrochemical sector, DIMETHYL 2,3-DIBROMO-1,4-BUTANEDIOATE is employed as a reagent for the production of agrochemicals. Its application contributes to the development of effective and innovative solutions for agricultural challenges.
Used in Specialty Chemicals Industry:
DIMETHYL 2,3-DIBROMO-1,4-BUTANEDIOATE is utilized as a building block in the creation of complex organic molecules for specialty chemicals. Its versatility and reactivity make it an essential component in the synthesis of high-value specialty chemicals.
Used in Medicinal Chemistry:
As a key component in medicinal chemistry, DIMETHYL 2,3-DIBROMO-1,4-BUTANEDIOATE is used for the synthesis of complex organic molecules with potential therapeutic applications. Its unique properties enable the development of novel compounds with improved efficacy and selectivity in treating various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 1186-98-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,8 and 6 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 1186-98:
(6*1)+(5*1)+(4*8)+(3*6)+(2*9)+(1*8)=87
87 % 10 = 7
So 1186-98-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H8Br2O4/c1-11-5(9)3(7)4(8)6(10)12-2/h3-4H,1-2H3/t3-,4-/m1/s1