124244-65-1 Usage
Uses
Used in Pharmaceutical Industry:
2-Bromo-3,6-difluorobenzoic acid is used as a building block for the synthesis of various pharmaceuticals due to its unique chemical structure and strong acidity. Its presence in the molecular structure of drugs can enhance their pharmacological properties, such as potency, selectivity, and bioavailability.
Used in Agrochemical Industry:
2-Bromo-3,6-difluorobenzoic acid is used as a key intermediate in the synthesis of agrochemicals, including pesticides and herbicides. Its strong acidity and unique functional groups contribute to the development of effective and environmentally friendly agrochemicals.
Used in Organic Chemistry Research:
2-Bromo-3,6-difluorobenzoic acid is used as a reagent in various organic chemistry reactions, such as esterification, amidation, and acylation. Its strong acidity facilitates the formation of desired products and improves the efficiency of the reactions.
Used in Materials Science:
2-Bromo-3,6-difluorobenzoic acid has potential applications in materials science, such as the development of new polymers, coatings, and adhesives. Its unique chemical structure and properties can contribute to the creation of innovative materials with improved performance and functionality.
Check Digit Verification of cas no
The CAS Registry Mumber 124244-65-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,4,2,4 and 4 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 124244-65:
(8*1)+(7*2)+(6*4)+(5*2)+(4*4)+(3*4)+(2*6)+(1*5)=101
101 % 10 = 1
So 124244-65-1 is a valid CAS Registry Number.
InChI:InChI=1S/C7H3BrF2O2/c8-6-4(10)2-1-3(9)5(6)7(11)12/h1-2H,(H,11,12)
124244-65-1Relevant academic research and scientific papers
Regioselective ortho-lithiation of chloro and bromo substituted fluoroarenes
Mongin, Florence,Schlosser, Manfred
, p. 6551 - 6554 (2007/10/03)
Deprotonation of fluoroarenes carrying chlorine or bromine as additional substituents occurs always at a fluorine adjacent position if accomplished with potassium tert-butoxide activated butyllithium or lithium 2,2,6,6-tetramethylpiperidide.