1259079-26-9Relevant academic research and scientific papers
Reaction of lanthanide(II) and lanthanide(III) phenylethynyl cuprates with acetyl chloride
Zhil'tsov,Dydykina,Druzhkova
, p. 1767 - 1770 (2010)
Praseodymium and ytterbium phenylethynyl cuprates [(PhC≡C) 3Cu]3Pr2(THF)6 and {[(PhC≡C)3Cu]?Yb(THF)2}2 react with acetyl chloride in tetrahydrofuran with elimination of phenylethynylcopper and formation of alkoxides [PhC≡C-CCl(CH3)O] n Ln (n = 3, Ln = Pr; n = 2, Ln = Yb). Then praseodymium alkoxide forms ester [methyl (phenylethynyl)chloromethylethanoate] and praseodymium chloride, alkoxy derivative. Itterbium alkoxide is oxidized to unsymmetrical dialkoxyitterbium chloride PhC≡C-CH(CH3)-O-Yb(Cl)-O-CCl(CH3) C≡CPh?2THF.
