126325-50-6 Usage
Uses
Used in Pharmaceutical Industry:
3-Amino-2-bromo-4-picoline is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its reactivity and chemical properties make it a valuable component in the development of new drugs and medications.
Used in Chemical Research:
3-Amino-2-bromo-4-picoline is used as a reagent in various chemical reactions and processes, contributing to the advancement of scientific knowledge and the discovery of new chemical compounds.
Used in Agrochemical Applications:
3-Amino-2-bromo-4-picoline is used as a starting material for the synthesis of agrochemicals, such as pesticides and herbicides. Its properties enable the creation of effective and targeted agricultural products.
Used in Material Science Applications:
3-Amino-2-bromo-4-picoline is used in the development of new materials with specific properties, such as improved strength, durability, or chemical resistance. Its versatility in chemical reactions allows for the creation of innovative materials for various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 126325-50-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,6,3,2 and 5 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 126325-50:
(8*1)+(7*2)+(6*6)+(5*3)+(4*2)+(3*5)+(2*5)+(1*0)=106
106 % 10 = 6
So 126325-50-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H7BrN2/c1-4-2-3-9-6(7)5(4)8/h2-3H,8H2,1H3
126325-50-6Relevant academic research and scientific papers
Bromination of Pyridines. II. Bromination of Aminopicolines
Dunn, A. D.,Currie, A.,Hayes, L. E.
, p. 369 - 374 (2007/10/02)
The bromination of all ten possible aminopicolines 1-10 was investigated.In general, the major brominated product was that corresponding to electrophilic attack at the sites para or ortho to the amino group.
