13008-17-8 Usage
Uses
Used in Pharmaceutical Industry:
4-methyl-2-chloro-pyrimidine-5-carboxylic acid is used as an intermediate in the synthesis of pharmaceuticals for its ability to be incorporated into the molecular structures of various drugs. Its presence in the compound can influence the drug's properties, such as solubility, stability, and biological activity.
Used in Agrochemical Industry:
In the agrochemical sector, 4-methyl-2-chloro-pyrimidine-5-carboxylic acid is utilized as a building block for the development of new agrochemicals. Its unique structure allows it to be a key component in the creation of pesticides, herbicides, and other agricultural chemicals that can enhance crop protection and yield.
Used in Dye Industry:
4-methyl-2-chloro-pyrimidine-5-carboxylic acid is employed in the dye industry as a precursor for the production of various dyes. Its chemical structure contributes to the color properties and stability of the dyes, making it suitable for use in textiles, plastics, and other coloring applications.
Used in Organic Reactions:
4-methyl-2-chloro-pyrimidine-5-carboxylic acid is also used in various organic reactions as a reagent or catalyst. Its ability to participate in a range of chemical transformations makes it a valuable tool in the synthesis of complex organic molecules and the development of new chemical processes.
Used as a Building Block for Chemical Compounds:
4-methyl-2-chloro-pyrimidine-5-carboxylic acid serves as a fundamental building block for the production of other chemical compounds. Its versatile structure allows it to be a component in the synthesis of a wide array of molecules, contributing to the advancement of chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 13008-17-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,0,0 and 8 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 13008-17:
(7*1)+(6*3)+(5*0)+(4*0)+(3*8)+(2*1)+(1*7)=58
58 % 10 = 8
So 13008-17-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H5ClN2O2/c1-3-4(5(10)11)2-8-6(7)9-3/h2H,1H3,(H,10,11)
13008-17-8Relevant academic research and scientific papers
Investigation on possibility of rearrangement of pyrimidine-5-carboxylic acids esters
Scherbinina,Dar'In,Lobanov
experimental part, p. 1109 - 1115 (2011/10/02)
A previously reported rearrangement of pyrimidine-5-carboxylic acids esters to 5-acylpyrimidones does not, in fact, occur in any of the examples studied by us.
