131063-65-5 Usage
General Description
(2-amino-3,4-dihydroxy-5-hydroxymethyl-1-cyclohexyl)glucopyranoside is a chemical compound with a complex structure containing amino and hydroxyl groups. It is a derivative of glucopyranoside, which is a type of sugar molecule. The compound contains a cyclohexyl ring and multiple hydroxyl groups, making it a highly polar and water-soluble molecule. (2-amino-3,4-dihydroxy-5-hydroxymethyl-1-cyclohexyl)glucopyranoside may have potential applications in pharmaceuticals, as it could potentially be used as a drug or drug component due to its structural and functional properties. Its complex structure and potential pharmaceutical applications make it an interesting chemical compound for further study and potential development.
Check Digit Verification of cas no
The CAS Registry Mumber 131063-65-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,1,0,6 and 3 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 131063-65:
(8*1)+(7*3)+(6*1)+(5*0)+(4*6)+(3*3)+(2*6)+(1*5)=85
85 % 10 = 5
So 131063-65-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H25NO9/c14-7-5(1-4(2-15)8(17)10(7)19)22-13-12(21)11(20)9(18)6(3-16)23-13/h4-13,15-21H,1-3,14H2