131063-65-5 Usage
Uses
Used in Pharmaceutical Industry:
(2-amino-3,4-dihydroxy-5-hydroxymethyl-1-cyclohexyl)glucopyranoside is used as a potential drug or drug component due to its structural and functional properties. Its complex molecular composition allows for versatile interactions with biological systems, offering opportunities for the development of novel therapeutic agents.
Given the information provided, there are no specific applications detailed for (2-amino-3,4-dihydroxy-5-hydroxymethyl-1-cyclohexyl)glucopyranoside other than its potential use in the pharmaceutical industry. Further research and development would be necessary to explore and confirm its specific applications and benefits in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 131063-65-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,1,0,6 and 3 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 131063-65:
(8*1)+(7*3)+(6*1)+(5*0)+(4*6)+(3*3)+(2*6)+(1*5)=85
85 % 10 = 5
So 131063-65-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H25NO9/c14-7-5(1-4(2-15)8(17)10(7)19)22-13-12(21)11(20)9(18)6(3-16)23-13/h4-13,15-21H,1-3,14H2
