13287-23-5 Usage
General Description
Heptadecane, 8-methyl- is a chemical compound that belongs to the group of alkanes, specifically a branched chain hydrocarbon containing 17 carbon atoms. It is a colorless liquid with a faint odor, commonly used in various industries such as cosmetics, perfumes, and in the production of synthetic lubricants. Heptadecane, 8-methyl- is known for its ability to moisturize and soften the skin, making it a popular ingredient in skincare products. Additionally, it is considered to be non-toxic and environmentally friendly, making it a versatile and safe option for a wide range of applications.
Check Digit Verification of cas no
The CAS Registry Mumber 13287-23-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,2,8 and 7 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 13287-23:
(7*1)+(6*3)+(5*2)+(4*8)+(3*7)+(2*2)+(1*3)=95
95 % 10 = 5
So 13287-23-5 is a valid CAS Registry Number.
InChI:InChI=1/C18H38/c1-4-6-8-10-11-13-15-17-18(3)16-14-12-9-7-5-2/h18H,4-17H2,1-3H3