134822-76-7 Usage
General Description
6-Hydroxychromene-3-carboxaldehyde is a chemical compound with a complex molecular structure consisting of a chromene ring, a hydroxyl group, and a carboxaldehyde functional group. It is commonly used as a building block for the synthesis of various organic compounds and pharmaceuticals. 6-HYDROXYCHROMENE-3-CARBOXALDEHYDE has been found to exhibit potential biological activities such as antioxidant, antibacterial, and antifungal properties, making it a subject of interest in medicinal chemistry research. Its unique structure and reactivity make it a valuable tool in the development of new drug molecules and functional materials.
Check Digit Verification of cas no
The CAS Registry Mumber 134822-76-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,4,8,2 and 2 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 134822-76:
(8*1)+(7*3)+(6*4)+(5*8)+(4*2)+(3*2)+(2*7)+(1*6)=127
127 % 10 = 7
So 134822-76-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H8O3/c11-5-7-3-8-4-9(12)1-2-10(8)13-6-7/h1-5,12H,6H2
134822-76-7Relevant articles and documents
Substituted heterocyclic compounds, method for preparing and compositions containing same
-
, (2008/06/13)
The invention relates to compounds of formula (I): wherein: R1, R2and R3are as defined in the description, X is as defined in the description, Y represents an oxygen atom, a sulphur atom, a C(H)qgroup, SO or SO2, n is equal to from 0 to 5, A represents a NR5R6group, and medicinal products containing the same which are useful in treating or in preventing melatoninergic disorders.
CERTAIN BENZOPYRAN AND BENZOTHIOPYRAN DERIVATIVES
-
, (2008/06/13)
The invention relates to the compounds of the formula wherein each R independently represents hydrogen, lower alkyl, halogen, trifluoromethyl, lower alkoxy, carbocyclic or heterocyclic aryl, carbocyclic or heterocyclic aryloxy, carbocyclic or heterocyclic