13566-48-8 Usage
Uses
Used in Pharmaceutical Synthesis:
4,6-Dimethoxy-2-methylpyrimidine is used as an intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of novel drug molecules. Its unique structure allows for the creation of compounds with specific therapeutic properties, enhancing the range of available treatments.
Used in Agrochemical Synthesis:
In the agrochemical industry, 4,6-Dimethoxy-2-methylpyrimidine is utilized as a key component in the formulation of pesticides and other agricultural chemicals. Its incorporation can lead to the development of more effective and targeted agrochemicals, improving crop protection and yield.
Used in Antifungal Applications:
4,6-Dimethoxy-2-methylpyrimidine is used as an antifungal agent due to its inherent properties that combat fungal infections. This makes it a potential candidate for the development of new antifungal drugs, addressing the need for novel treatments in medical and agricultural settings.
Used in Antimicrobial Applications:
4,6-Dimethoxy-2-methylpyrimidine is also used as an antimicrobial agent, leveraging its ability to inhibit the growth of microorganisms. This application is crucial in various fields, including medicine for treating infections and in industrial processes to maintain sterility and product integrity.
Overall, 4,6-Dimethoxy-2-methylpyrimidine is a versatile compound with a broad spectrum of applications across different industries, underpinned by its unique chemical structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 13566-48-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,5,6 and 6 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 13566-48:
(7*1)+(6*3)+(5*5)+(4*6)+(3*6)+(2*4)+(1*8)=108
108 % 10 = 8
So 13566-48-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O2/c1-5-8-6(10-2)4-7(9-5)11-3/h4H,1-3H3
