147542-00-5 Usage
Description
3-Fluoro-4-methylbenzyl chloride is a chemical compound with the molecular formula C8H8ClF. It is a benzyl chloride derivative with a fluorine and a methyl group attached to the benzene ring. 3-Fluoro-4-methylbenzyl chloride is known for its reactivity and versatility, making it a valuable intermediate in organic synthesis.
Uses
Used in Pharmaceutical Industry:
3-Fluoro-4-methylbenzyl chloride is used as a building block for the synthesis of various pharmaceuticals. Its unique structure allows for the creation of a wide range of functionalized benzyl compounds, which can be further utilized in the development of new drugs.
Used in Agrochemical Industry:
In the agrochemical sector, 3-Fluoro-4-methylbenzyl chloride serves as a key intermediate for the production of various agrochemicals. Its ability to undergo nucleophilic substitution and addition reactions enables the synthesis of compounds with potential applications in crop protection and pest control.
Used in Fine Chemicals Industry:
3-Fluoro-4-methylbenzyl chloride is also utilized in the synthesis of fine chemicals, which are high-purity chemicals used in various applications such as fragrances, dyes, and specialty chemicals. Its reactivity and potential for functionalization make it an important compound in this field.
Overall, 3-Fluoro-4-methylbenzyl chloride is a significant compound in the field of organic chemistry due to its reactivity, versatility, and potential applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 147542-00-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,7,5,4 and 2 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 147542-00:
(8*1)+(7*4)+(6*7)+(5*5)+(4*4)+(3*2)+(2*0)+(1*0)=125
125 % 10 = 5
So 147542-00-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H8ClF/c1-6-2-3-7(5-9)4-8(6)10/h2-4H,5H2,1H3
147542-00-5Relevant articles and documents
Gem-substituted αvβ3 antagonists
-
, (2008/06/13)
The present invention relates to a class of compounds represented by the Formula I. or a pharmaceutically acceptable salt thereof, pharmaceutical compositions comprising compounds of the Formula I, and methods of selectively inhibiting or antagonizing the αVβ3and/or the αVβ5integrin.
