149281-90-3 Usage
Uses
Used in Pharmaceutical Industry:
1-Benzyl-1-methoxy-3-phenylurea is used as a building block for the synthesis of complex organic molecules, contributing to the development of new pharmaceutical compounds. Its unique structure allows for the creation of diverse drug candidates with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 1-Benzyl-1-methoxy-3-phenylurea is utilized as a precursor in the synthesis of various agrochemicals, such as herbicides, insecticides, and fungicides. Its versatile chemical structure enables the development of effective and targeted pest control solutions.
Check Digit Verification of cas no
The CAS Registry Mumber 149281-90-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,9,2,8 and 1 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 149281-90:
(8*1)+(7*4)+(6*9)+(5*2)+(4*8)+(3*1)+(2*9)+(1*0)=153
153 % 10 = 3
So 149281-90-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H16N2O2/c1-19-17(12-13-8-4-2-5-9-13)15(18)16-14-10-6-3-7-11-14/h2-11H,12H2,1H3,(H,16,18)
