15310-87-9 Usage
Uses
Used in Organic Synthesis:
(2,5-DIMETHYL-PHENYLSULFANYL)-ACETIC ACID is used as a building block in organic synthesis for the preparation of a variety of organic compounds. Its unique structure allows for the creation of diverse chemical entities, contributing to the development of new materials and compounds with specific properties.
Used in Pharmaceutical Research:
In the pharmaceutical industry, (2,5-DIMETHYL-PHENYLSULFANYL)-ACETIC ACID is utilized as a key intermediate in the synthesis of drug candidates. Its structural features may provide a foundation for the development of new therapeutic agents with potential biological or pharmacological activities.
Used in Chemical Research:
(2,5-DIMETHYL-PHENYLSULFANYL)-ACETIC ACID is employed in chemical research to explore its potential reactivity and properties. Understanding its behavior in various chemical reactions can lead to the discovery of new synthetic pathways and the creation of novel compounds with specific applications.
Used in Industrial Applications:
Due to its versatility, (2,5-DIMETHYL-PHENYLSULFANYL)-ACETIC ACID may find use in various industrial applications, such as the development of new materials, catalysts, or other chemical products. Its potential applications in these fields can contribute to advancements in technology and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 15310-87-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,3,1 and 0 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 15310-87:
(7*1)+(6*5)+(5*3)+(4*1)+(3*0)+(2*8)+(1*7)=79
79 % 10 = 9
So 15310-87-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H12O2S/c1-7-3-4-8(2)9(5-7)13-6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12)/p-1
15310-87-9Relevant academic research and scientific papers
ARYLSULFANYL COMPOUNDS AND COMPOSITIONS FOR DELIVERING ACTIVE AGENTS
-
Page/Page column 57, (2008/06/13)
Compounds and compositions for the delivery of active agents are provided. Methods of administration and preparation are also provided.
