15846-14-7 Usage
Uses
Used in Pharmaceutical Synthesis:
4,6-dimethoxy-5-nitropyrimidine is utilized as a key intermediate in the synthesis of pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique chemical structure allows for the creation of a variety of pyrimidine-based compounds with potential medicinal applications.
Used in Agrochemical Production:
In the agrochemical industry, 4,6-dimethoxy-5-nitropyrimidine serves as a vital component in the formulation of pesticides and other crop protection products. Its incorporation aids in enhancing the effectiveness of these chemicals, promoting agricultural productivity and crop health.
Used in Pyrimidine Derivative Preparation:
4,6-dimethoxy-5-nitropyrimidine is employed as a building block in the preparation of various pyrimidine derivatives, which are essential in organic chemistry and have a wide range of applications, including as synthetic intermediates and in the development of new chemical entities.
Used in Antifungal and Antibacterial Research:
4,6-dimethoxy-5-nitropyrimidine is being studied for its potential antifungal and antibacterial properties, making it a candidate for use in the development of new antimicrobial agents to combat resistant strains and improve public health.
Check Digit Verification of cas no
The CAS Registry Mumber 15846-14-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,8,4 and 6 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 15846-14:
(7*1)+(6*5)+(5*8)+(4*4)+(3*6)+(2*1)+(1*4)=117
117 % 10 = 7
So 15846-14-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H7N3O4/c1-12-5-4(9(10)11)6(13-2)8-3-7-5/h3H,1-2H3
