15846-15-8 Usage
Uses
Used in Pharmaceutical Synthesis:
5-Pyrimidinamine, 4,6-dimethoxyis used as a key intermediate in the synthesis of various pharmaceuticals and biologically active compounds. Its unique molecular structure allows for the development of new drugs with potential therapeutic benefits.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 5-Pyrimidinamine, 4,6-dimethoxyis utilized for studying its pharmacological properties and exploring its potential as a therapeutic agent. Researchers are investigating its interactions with biological targets and evaluating its efficacy in treating various diseases.
Used in Drug Development:
5-Pyrimidinamine, 4,6-dimethoxyis employed in drug development for its potential applications in treating a range of diseases. Its unique molecular structure and pharmacological properties make it a valuable candidate for the development of novel therapeutic agents.
Used in Biologically Active Compounds Synthesis:
This chemical compound is also used in the synthesis of biologically active compounds, which can have various applications in the pharmaceutical and biotechnology industries. Its ability to modulate biological processes makes it a valuable component in the development of new drugs and therapies.
Overall, 5-Pyrimidinamine, 4,6-dimethoxyis a versatile chemical compound with significant potential in the fields of pharmaceutical synthesis, medicinal chemistry research, drug development, and the synthesis of biologically active compounds. Its unique molecular structure and pharmacological properties make it a promising candidate for the development of novel therapeutic agents and treatments for various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 15846-15-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,8,4 and 6 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 15846-15:
(7*1)+(6*5)+(5*8)+(4*4)+(3*6)+(2*1)+(1*5)=118
118 % 10 = 8
So 15846-15-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H9N3O2/c1-10-5-4(7)6(11-2)9-3-8-5/h3H,7H2,1-2H3
15846-15-8Relevant academic research and scientific papers
Carboxamide derivatives
-
, (2008/06/13)
Carboxamide derivatives of the following general formula (I): STR1 (wherein R1 and R2 are C1 -C3 alkyl group or both taken together C1 -C3 alkylene group, R3 is hydrogen atom, di
TRANSFORMATIONS OF SUBSTITUTED 5-AMINOPYRIMIDINES UNDER CONDITIONS OF THE DIAZOTIZATION
Nemeryuk, Michal P.,Sedov, Andrej L.,Safonova, Tamara S.,Cerny, Antonin,Krepelka, Jiri
, p. 215 - 233 (2007/10/02)
Reaction of nitrous acid with 4-substituted and 4,6-disubstituted 5-aminopyrimidines Ia-In produces 4-substituted and 4,5-disubstituted 1,2,3-triazoles IIa-IIv, resp.Under similar conditions, 2,5-diaminopyrimidines XIIa-XIId give N(7)-oxides of 2-amino-4-aralkylthiopyrimido-1,2,3-triazines XIIIa-XIIId, and 5-amino-4-chloropyrimidines In and X give 2-diazocyanoacetamides XIa and XIb, resp.Also described are syntheses of 5-formylaminopyrimidines XVa-XVg from glycine ethyl ester via sodium salt XVI.
