15971-30-9 Usage
Uses
Used in Pharmaceutical Industry:
3-(4-Methoxy-1-naphthyl)acrylic acid is used as a starting material for the production of various pharmaceuticals. Its unique chemical structure allows for the synthesis of a wide range of bioactive compounds with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 3-(4-Methoxy-1-naphthyl)acrylic acid is used as a building block for the synthesis of various agrochemicals. Its versatile chemical properties enable the development of new compounds with improved efficacy and selectivity in crop protection.
Used in Material Science:
3-(4-Methoxy-1-naphthyl)acrylic acid has potential applications in the development of new materials. Its unique chemical structure can be utilized to create novel materials with specific properties, such as improved stability, enhanced reactivity, or tailored physical characteristics.
Used as a Reagent in Organic Synthesis:
In organic synthesis, 3-(4-Methoxy-1-naphthyl)acrylic acid serves as a valuable reagent. Its ability to participate in various chemical reactions, such as addition, substitution, and condensation, makes it a useful component in the synthesis of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 15971-30-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,9,7 and 1 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 15971-30:
(7*1)+(6*5)+(5*9)+(4*7)+(3*1)+(2*3)+(1*0)=119
119 % 10 = 9
So 15971-30-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H12O3/c1-17-13-8-6-10(7-9-14(15)16)11-4-2-3-5-12(11)13/h2-9H,1H3,(H,15,16)/b9-7+
15971-30-9Relevant academic research and scientific papers
Evaluation of synthetic naphthalene derivatives as novel chemical chaperones that mimic 4-phenylbutyric acid
Mimori, Seisuke,Koshikawa, Yukari,Mashima, Yu,Mitsunaga, Katsuyoshi,Kawada, Koichi,Kaneko, Masayuki,Okuma, Yasunobu,Nomura, Yasuyuki,Murakami, Yasuoki,Kanzaki, Tetsuto,Hamana, Hiroshi
, p. 811 - 814 (2015/02/19)
The chemical chaperone 4-phenylbutyric acid (4-PBA) has potential as an agent for the treatment of neurodegenerative diseases. However, the requirement of high concentrations warrants chemical optimization for clinical use. In this study, novel naphthalene derivatives with a greater chemical chaperone activity than 4-PBA were synthesized with analogy to the benzene ring. All novel compounds showed chemical chaperone activity, and 2 and 5 possessed high activity. In subsequent experiments, the protective effects of the compounds were examined in Parkinson's disease model cells, and low toxicity of 9 and 11 was related to amphiphilic substitution with naphthalene.
