16015-47-7 Usage
Uses
Used in Pharmaceutical Industry:
3-METHYL-4-OXO-3,4-DIHYDRO-PHTHALAZINE-1-CARBOXYLIC ACID is used as a potential drug candidate for the development of new medications due to its unique chemical structure and properties. Its potential biological activity makes it a valuable compound for further research in medicinal chemistry.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 3-METHYL-4-OXO-3,4-DIHYDRO-PHTHALAZINE-1-CARBOXYLIC ACID is used as a subject of study to explore its potential biological activity and therapeutic effects. Its unique structure and functional groups may contribute to the discovery of new drug targets and the development of innovative treatment options.
Check Digit Verification of cas no
The CAS Registry Mumber 16015-47-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,0,1 and 5 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 16015-47:
(7*1)+(6*6)+(5*0)+(4*1)+(3*5)+(2*4)+(1*7)=77
77 % 10 = 7
So 16015-47-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N2O3/c1-12-9(13)7-5-3-2-4-6(7)8(11-12)10(14)15/h2-5H,1H3,(H,14,15)/p-1
16015-47-7Relevant academic research and scientific papers
Facile synthesis of novel 7-aminofuro- and 7-aminothieno[2,3-d]pyridazin- 4(5H)-one and 4-aminophthalazin-1(2H)-ones
Koza, Gani,Keskin, Selbi,?zer, Merve Sinem,Cengiz, Betül,?ahin, Ertan,Balci, Metin
, p. 395 - 409 (2013/01/15)
We hereby report the synthesis of a novel class of compounds, 7-aminofuro- and 7-aminothieno[2,3-d]pyridazin-4(5H)-one and 4-aminophthalazin-1(2H)-ones starting from methyl 2-(2-methoxy-2-oxoethyl)furan- and thiophene-3-carboxylate and methyl 2-(2-methoxy
