162102-81-0 Usage
Uses
Used in Pharmaceutical Industry:
4-BROMOPYRIDINE-2,6-DICARBOXYLIC ACID is used as an intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drugs and medications. Its unique chemical structure allows for the creation of various medicinal compounds that can address specific health conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 4-BROMOPYRIDINE-2,6-DICARBOXYLIC ACID is utilized as an intermediate in the production of agrochemicals, such as pesticides and herbicides. Its chemical properties enable the development of effective solutions for agricultural applications, promoting crop protection and yield enhancement.
Used in Dye and Pigment Production:
4-BROMOPYRIDINE-2,6-DICARBOXYLIC ACID is employed as a building block in the manufacturing of dyes and pigments. Its chemical composition allows for the creation of a wide range of colorants used in various industries, including textiles, plastics, and printing inks, to achieve desired colorations and visual effects.
Used in Research and Development:
4-BROMOPYRIDINE-2,6-DICARBOXYLIC ACID is also used in research and development settings as a versatile chemical for exploring new chemical reactions and syntheses. Its unique properties make it a valuable component in the discovery of novel compounds and materials with potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 162102-81-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,2,1,0 and 2 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 162102-81:
(8*1)+(7*6)+(6*2)+(5*1)+(4*0)+(3*2)+(2*8)+(1*1)=90
90 % 10 = 0
So 162102-81-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H4BrNO4/c8-3-1-4(6(10)11)9-5(2-3)7(12)13/h1-2H,(H,10,11)(H,12,13)
