1644-86-6 Usage
Description
2,2-Difluoro-6-nitro-benzo[1,3]dioxol-5-ylamine, with the CAS number 1644-86-6, is a yellow solid compound that plays a significant role in organic synthesis. Its unique chemical structure, featuring a benzene ring with a difluoro and nitro group, as well as a benzo[1,3]dioxol-5-ylamine moiety, makes it a versatile building block for the creation of various organic compounds.
Uses
Used in Organic Synthesis:
2,2-Difluoro-6-nitro-benzo[1,3]dioxol-5-ylamine is used as a key intermediate in the synthesis of complex organic molecules. Its presence in the molecule allows for a wide range of chemical reactions, such as nucleophilic substitution, electrophilic aromatic substitution, and reductive amination, which can be employed to modify and functionalize the compound for specific applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,2-Difluoro-6-nitro-benzo[1,3]dioxol-5-ylamine is used as a precursor for the development of new drugs. Its unique chemical properties and reactivity make it a valuable component in the synthesis of bioactive molecules with potential therapeutic applications.
Used in Agrochemical Industry:
2,2-Difluoro-6-nitro-benzo[1,3]dioxol-5-ylamine is also utilized in the agrochemical industry for the synthesis of novel pesticides and herbicides. Its ability to form various derivatives through chemical reactions allows for the development of new compounds with improved efficacy and selectivity against target pests and weeds.
Used in Dye and Pigment Industry:
In the dye and pigment industry, 2,2-Difluoro-6-nitro-benzo[1,3]dioxol-5-ylamine is used as a building block for the synthesis of new dyes and pigments. Its unique color properties and chemical structure contribute to the development of innovative colorants with improved performance and stability.
Used in Material Science:
2,2-Difluoro-6-nitro-benzo[1,3]dioxol-5-ylamine is employed in material science for the development of new polymers and materials with specific properties. Its reactivity and functional groups can be used to create polymers with tailored characteristics, such as improved mechanical strength, thermal stability, or electrical conductivity.
Check Digit Verification of cas no
The CAS Registry Mumber 1644-86-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,6,4 and 4 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1644-86:
(6*1)+(5*6)+(4*4)+(3*4)+(2*8)+(1*6)=86
86 % 10 = 6
So 1644-86-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H4F2N2O4/c8-7(9)14-5-1-3(10)4(11(12)13)2-6(5)15-7/h1-2H,10H2
1644-86-6Relevant articles and documents
Synthesis of carbon-11-labeled CK1 inhibitors as new potential PET radiotracers for imaging of Alzheimer's disease
Gao, Mingzhang,Wang, Min,Zheng, Qi-Huang
, p. 2234 - 2238 (2018)
The reference standards methyl 3-((2,2-difluoro-5H-[1,3]dioxolo[4′,5′:4,5]benzo[1,2-d]imidazol-6-yl)carbamoyl)benzoate (5a) and N-(2,2-difluoro-5H-[1,3]dioxolo[4′,5′:4,5]benzo[1,2-d]imidazol-6-yl)-3-methoxybenzamide (5c), and their corresponding desmethylated precursors 3-((2,2-difluoro-5H-[1,3]dioxolo[4′,5′:4,5]benzo[1,2-d]imidazol-6-yl)carbamoyl)benzoic acid (6a) and N-(2,2-difluoro-5H-[1,3]dioxolo[4′,5′:4,5]benzo[1,2-d]imidazol-6-yl)-3-hydroxybenzamide (6b), were synthesized from 5-amino-2,2-difluoro-1,3-benzodioxole and 3-substituted benzoic acids in 5 and 6 steps with 33% and 11%, 30% and 7% overall chemical yield, respectively. Carbon-11-labeled casein kinase 1 (CK1) inhibitors, [11C]methyl 3-((2,2-difluoro-5H-[1,3]dioxolo[4′,5′:4,5]benzo[1,2-d]imidazol-6-yl)carbamoyl)benzoate ([11C]5a) and N-(2,2-difluoro-5H-[1,3]dioxolo[4′,5′:4,5]benzo[1,2-d]imidazol-6-yl)-3-[11C]methoxybenzamide ([11C]5c), were prepared from their O-desmethylated precursor 6a or 6b with [11C]CH3OTf through O-[11C]methylation and isolated by HPLC combined with SPE in 40–45% radiochemical yield, based on [11C]CO2 and decay corrected to end of bombardment (EOB). The radiochemical purity was >99%, and the molar activity (MA) at EOB was 370–740 GBq/μmol with a total synthesis time of ～40-min from EOB.
Difluoro-dioxolo-benzoimidazol-benzamides as potent inhibitors of CK1δ and ε with nanomolar inhibitory activity on cancer cell proliferation
Richter, Julia,Bischof, Joachim,Zaja, Mirko,Kohlhof, Hella,Othersen, Olaf,Vitt, Daniel,Alscher, Vanessa,Pospiech, Irmgard,García-Reyes, Balbina,Berg, Sebastian,Leban, Johann,Knippschild, Uwe
, p. 7933 - 7946 (2014/12/10)
Deregulation of CK1 (casein kinase 1) activity can be involved in the development of several pathological disorders and diseases such as cancer. Therefore, research interest in identifying potent CK1-specific inhibitors is still increasing. A previously p
