16441-28-4 Usage
Uses
Used in Pharmaceutical Industry:
(2-Phenyl-thiazol-4-yl)-acetic acid is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure, including the thiazole ring and phenyl group, allows for the creation of new drug molecules with potential therapeutic applications.
Used in Chemical Research:
In the field of chemical research, (2-Phenyl-thiazol-4-yl)-acetic acid serves as a valuable compound for studying the properties and reactions of organosulfur compounds. Its reactivity and behavior can provide insights into the development of new chemical processes and materials.
Used in Material Science:
(2-Phenyl-thiazol-4-yl)-acetic acid is used as a building block in the development of new materials with specific properties. Its incorporation into polymers or other materials can lead to the creation of materials with enhanced characteristics, such as improved stability or reactivity.
Used in Environmental Applications:
(2-Phenyl-thiazol-4-yl)-acetic acid may be employed in environmental applications, such as in the development of new methods for pollution control or remediation. Its reactivity and interaction with other compounds could potentially be harnessed to address environmental challenges.
Check Digit Verification of cas no
The CAS Registry Mumber 16441-28-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,4,4 and 1 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 16441-28:
(7*1)+(6*6)+(5*4)+(4*4)+(3*1)+(2*2)+(1*8)=94
94 % 10 = 4
So 16441-28-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H9NO2S/c13-10(14)6-9-7-15-11(12-9)8-4-2-1-3-5-8/h1-5,7H,6H2,(H,13,14)/p-1
16441-28-4Relevant academic research and scientific papers
Ramoplanin derivatives possessing antibacterial activity
-
Page/Page column 70, (2010/11/23)
Novel ramoplanin derivatives are disclosed. These ramoplanin derivatives exhibit antibacterial activity. As the compounds of the subject invention exhibit potent activities against gram positive bacteria, they are useful antimicrobial agents. Methods of synthesis and of use of the compounds are also disclosed.
Antibiotic derivatives of 7β-[2-(thiazol-4-yl)acetamide]-3-chloro-3-cephem-4-carboxylic acids and compositions and method of use thereof
-
, (2008/06/13)
7β-Heterocyclicacetylamino-(and 7β-heterocyclicthioacetamido)-3-chloro-3-cephem-4-carboxylic acids and pharmaceutically acceptable salts thereof, e.g., 7β-[2-(2-aminothiazol-4-yl)acetamido]-3-chloro-3-cephem-4-carboxylic acid and salts thereof, exhibit su