165258-72-0 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
2-Amino-4-diethylamino-6-fluoropyrimidine is used as a building block in the synthesis of pharmaceuticals and agrochemicals due to its potential in drug discovery. Its unique structure allows for the development of new therapeutic agents and compounds with specific biological activities.
Used in Material Science:
2-Amino-4-diethylamino-6-fluoropyrimidine may have applications in the field of material science, where its unique chemical properties can be utilized to create new materials with specific characteristics.
Used as a Reagent in Chemical Research:
2-AMINO-4-DIETHYLAMINO-6-FLUOROPYRIMIDINE can also be used as a reagent in chemical research, where it can be employed in various chemical reactions and processes to study its properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 165258-72-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,5,2,5 and 8 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 165258-72:
(8*1)+(7*6)+(6*5)+(5*2)+(4*5)+(3*8)+(2*7)+(1*2)=150
150 % 10 = 0
So 165258-72-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H13FN4/c1-3-13(4-2)7-5-6(9)11-8(10)12-7/h5H,3-4H2,1-2H3,(H2,10,11,12)
165258-72-0Relevant academic research and scientific papers
Synthesis and Properties of 2,4-Disubstituted 6-Fluoropyrimidines
Popova,Studentsov
, p. 1376 - 1381 (2007/10/03)
Reaction of 2,4,6-trifluoropyrimidine and 2- and 4-aminodifluoropyrimidines with various amines in DMF is studied. As a result, a series of new 2,4-diamino-substituted 6-fluoropyrimidines with similar or different amino substituents are synthesized.
