17279-63-9 Usage
Uses
Used in Pharmaceutical Industry:
7A-METHYL-5-OXOHEXAHYDROPYRROLO[2,1-B][1,3]THIAZOLE-3-CARBOXYLIC ACID is used as a building block in the synthesis of other organic compounds, particularly for the development of pharmaceuticals. Its unique structure and properties may contribute to the creation of new drugs with potential therapeutic applications.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 7A-METHYL-5-OXOHEXAHYDROPYRROLO[2,1-B][1,3]THIAZOLE-3-CARBOXYLIC ACID is utilized for studying its interactions with biological targets and exploring its potential as a lead compound for drug discovery. Its complex structure allows researchers to investigate various chemical modifications and their effects on biological activity.
Used in Organic Synthesis:
7A-METHYL-5-OXOHEXAHYDROPYRROLO[2,1-B][1,3]THIAZOLE-3-CARBOXYLIC ACID is employed as an intermediate in organic synthesis processes. Its reactivity and functional groups make it a valuable component in the preparation of more complex organic molecules for various applications, including materials science and specialty chemicals.
Further research and exploration of 7A-METHYL-5-OXOHEXAHYDROPYRROLO[2,1-B][1,3]THIAZOLE-3-CARBOXYLIC ACID's potential uses may yield valuable insights and practical applications in a range of industries, highlighting its versatility and importance in the realm of chemical sciences.
Check Digit Verification of cas no
The CAS Registry Mumber 17279-63-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,2,7 and 9 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 17279-63:
(7*1)+(6*7)+(5*2)+(4*7)+(3*9)+(2*6)+(1*3)=129
129 % 10 = 9
So 17279-63-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H11NO3S/c1-8-3-2-6(10)9(8)5(4-13-8)7(11)12/h5H,2-4H2,1H3,(H,11,12)
