17386-09-3 Usage
General Description
4-(pyrrolidin-1-ylmethyl)-1,3-thiazol-2-amine is a chemical compound with the molecular formula C9H14N4S. It is a thiazole derivative with a pyrrolidine functional group attached to the thiazole ring. 4-(PYRROLIDIN-1-YLMETHYL)-1,3-THIAZOL-2-AMINE is of interest in medicinal chemistry due to its potential pharmacological properties, as thiazole derivatives are known to exhibit a wide range of biological activities, including antimicrobial, anticancer, and antiviral effects. The pyrrolidine group in the molecule also contributes to its potential pharmacological activity, as pyrrolidine derivatives have been studied for their various therapeutic applications. Further research is needed to fully understand the biological and pharmaceutical potential of 4-(pyrrolidin-1-ylmethyl)-1,3-thiazol-2-amine.
Check Digit Verification of cas no
The CAS Registry Mumber 17386-09-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,3,8 and 6 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 17386-09:
(7*1)+(6*7)+(5*3)+(4*8)+(3*6)+(2*0)+(1*9)=123
123 % 10 = 3
So 17386-09-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H13N3S/c9-8-10-7(6-12-8)5-11-3-1-2-4-11/h6H,1-5H2,(H2,9,10)/p+1
