17386-09-3 Usage
Uses
Used in Pharmaceutical Industry:
4-(PYRROLIDIN-1-YLMETHYL)-1,3-THIAZOL-2-AMINE is used as a potential therapeutic agent for its antimicrobial properties, making it a candidate for the development of new antibiotics to combat resistant bacteria.
Used in Anticancer Research:
In the field of oncology, 4-(PYRROLIDIN-1-YLMETHYL)-1,3-THIAZOL-2-AMINE is used as a compound of interest for its potential anticancer effects, warranting further investigation into its ability to target and inhibit cancer cell growth.
Used in Antiviral Drug Development:
4-(PYRROLIDIN-1-YLMETHYL)-1,3-THIAZOL-2-AMINE is utilized as a starting point for the development of antiviral drugs, given its potential to inhibit viral replication and infectivity.
Used in Medicinal Chemistry Research:
4-(PYRROLIDIN-1-YLMETHYL)-1,3-THIAZOL-2-AMINE serves as a valuable research tool in medicinal chemistry for the synthesis of new drugs and the study of structure-activity relationships, given its unique thiazole and pyrrolidine structural features.
Check Digit Verification of cas no
The CAS Registry Mumber 17386-09-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,3,8 and 6 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 17386-09:
(7*1)+(6*7)+(5*3)+(4*8)+(3*6)+(2*0)+(1*9)=123
123 % 10 = 3
So 17386-09-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H13N3S/c9-8-10-7(6-12-8)5-11-3-1-2-4-11/h6H,1-5H2,(H2,9,10)/p+1
