1780-48-9 Usage
General Description
2-BENZOYLVALERONITRILE, also known as diethyl (2-cyano-2-phenylacetyl)malonate, is a chemical compound commonly used in organic synthesis and pharmaceutical research. It is a versatile intermediate and building block for the synthesis of various pharmaceuticals and agrochemicals. 2-BENZOYLVALERONITRILE is a key starting material for the production of various drugs and other bioactive molecules due to its unique chemical properties. Additionally, 2-BENZOYLVALERONITRILE has been the subject of numerous research studies for its potential applications in drug discovery and development. Overall, this chemical compound plays a significant role in the pharmaceutical and chemical industries and has potential for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 1780-48-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,7,8 and 0 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 1780-48:
(6*1)+(5*7)+(4*8)+(3*0)+(2*4)+(1*8)=89
89 % 10 = 9
So 1780-48-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H13NO/c1-2-6-11(9-13)12(14)10-7-4-3-5-8-10/h3-5,7-8,11H,2,6H2,1H3
1780-48-9Relevant articles and documents
Sustainable Palladium-Catalyzed Tsuji-Trost Reactions Enabled by Aqueous Micellar Catalysis
Braga, Felipe C.,Gallou, Fabrice,Lee, Nicholas R.,Lippincott, Daniel J.,Lipshutz, Bruce H.,Moghadam, Farbod A.,Zhu, Bingchun
supporting information, (2020/07/15)
Palladium-catalyzed allylic substitution, or "Tsuji-Trost"reactions, can be run under micellar catalysis conditions featuring not only chemistry in water but also numerous combinations of reaction partners that require low levels of palladium, typically on the order of 1000 ppm (0.1 mol %). These couplings are further characterized by especially mild conditions, leading to a number of cases not previously reported in an aqueous micellar medium. Inclusion of diverse nucleophiles, such as N-H heterocycles, alcohols, dicarbonyl compounds, and sulfonamides is described. Intramolecular cyclizations further illustrate the broad utility of this process. In addition to recycling studies, a multigram scale example is reported, indicative of the prospects for scale up.
