182483-63-2 Usage
Description
2-Benzyloxy-6-chloro-isonicotinic acid is a chemical compound with the molecular formula C16H13ClNO3. It belongs to the isonicotinic acid family and features a benzyl ether group, a chloro substituent, and a carboxylic acid moiety attached to the pyridine ring. 2-BENZYLOXY-6-CHLORO-ISONICOTINIC ACID possesses potential pharmacological and biochemical properties, and its derivatives have been studied for their antitumor, antibacterial, antifungal, and anticonvulsant activities. Additionally, it is utilized in the synthesis of various pharmaceutical compounds and serves as a valuable building block for the development of new drug candidates and bioactive molecules.
Uses
Used in Pharmaceutical Industry:
2-Benzyloxy-6-chloro-isonicotinic acid is used as a key intermediate in the synthesis of pharmaceutical compounds for its potential pharmacological and biochemical properties. Its derivatives have been investigated for their antitumor, antibacterial, antifungal, and anticonvulsant activities, making it a promising candidate for the development of new drugs and therapies.
Used in Drug Development:
As a valuable building block, 2-Benzyloxy-6-chloro-isonicotinic acid is used in drug development for the creation of new drug candidates and bioactive molecules. Its unique structure and properties allow for the design and synthesis of innovative compounds with potential therapeutic applications in various medical fields.
Check Digit Verification of cas no
The CAS Registry Mumber 182483-63-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,2,4,8 and 3 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 182483-63:
(8*1)+(7*8)+(6*2)+(5*4)+(4*8)+(3*3)+(2*6)+(1*3)=152
152 % 10 = 2
So 182483-63-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H10ClNO3/c14-11-6-10(13(16)17)7-12(15-11)18-8-9-4-2-1-3-5-9/h1-7H,8H2,(H,16,17)
182483-63-2Relevant articles and documents
BACE-2 INHIBITORY COMPOUNDS AND RELATED METHODS OF USE
-
Paragraph 0140; 0144; 0160; 0162, (2017/05/02)
Provided herein are novel compounds of Formulae I-III, and methods of using the same to selectively inhibit BACE2.