1828-09-7 Usage
Uses
Used in Organic Synthesis:
4,4'-DIFLUORODIPHENYLIODONIUM CHLORIDE is used as a reagent for its ability to generate electrophilic difluorodiphenyliodonium cations, which are key in various organic synthesis processes. Its role in these reactions is crucial for the formation of complex organic molecules.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 4,4'-DIFLUORODIPHENYLIODONIUM CHLORIDE is utilized as a coupling agent to facilitate the formation of carbon-carbon and carbon-heteroatom bonds. This is particularly important in the synthesis of complex pharmaceutical compounds, where precise bond formation is essential for the development of effective drugs.
Used in Material Chemistry:
4,4'-DIFLUORODIPHENYLIODONIUM CHLORIDE is employed in material chemistry as a component in the synthesis of new materials with specific properties. Its contribution to the formation of carbon-heteroatom bonds is vital for the development of materials with tailored characteristics for various applications.
Used in Specialty Chemicals Production:
In the production of specialty chemicals, 4,4'-DIFLUORODIPHENYLIODONIUM CHLORIDE is used as a key intermediate, enabling the synthesis of unique chemical entities that possess specialized functions and properties, which are not readily available from conventional chemical processes.
Used in Pharmaceutical Development:
4,4'-DIFLUORODIPHENYLIODONIUM CHLORIDE is used as a valuable tool in the development of new pharmaceuticals. Its role in facilitating specific bond formations is crucial for the creation of novel drug candidates with improved efficacy and selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 1828-09-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,8,2 and 8 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1828-09:
(6*1)+(5*8)+(4*2)+(3*8)+(2*0)+(1*9)=87
87 % 10 = 7
So 1828-09-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H8F2I.ClH/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12;/h1-8H;1H/q+1;/p-1
