18436-69-6 Usage
Uses
Used in Pharmaceutical Industry:
ETHYL 4-CHLOROQUINOLINE-2-CARBOXYLATE is used as a key intermediate in the synthesis of various drugs, particularly those with antimalarial, antibacterial, and antifungal properties. Its carboxylate group facilitates the development of prodrugs, allowing for easy metabolism in the body to release the active drug.
Used in Organic Synthesis:
ETHYL 4-CHLOROQUINOLINE-2-CARBOXYLATE is utilized as a building block in the synthesis of complex organic molecules, contributing to the advancement of organic chemistry and the development of novel compounds with diverse applications.
Used in Drug Discovery:
ETHYL 4-CHLOROQUINOLINE-2-CARBOXYLATE's unique structure and properties make it a valuable candidate in drug discovery, where it can be further modified or used as a template to identify new therapeutic agents with improved efficacy and selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 18436-69-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,4,3 and 6 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 18436-69:
(7*1)+(6*8)+(5*4)+(4*3)+(3*6)+(2*6)+(1*9)=126
126 % 10 = 6
So 18436-69-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H10ClNO2/c1-2-16-12(15)11-7-9(13)8-5-3-4-6-10(8)14-11/h3-7H,2H2,1H3
18436-69-6Relevant academic research and scientific papers
ANTIBACTERIAL PIPERIDINE DERIVATIVES
-
Page/Page column 79, (2008/06/13)
Compounds of formula (I) and their pharmaceutically acceptable salts are described: Formula (I). Processes for their preparation, pharmaceutical compositions containing them, their use as medicaments and their use in the treatment of bacterial infections are also described.
