18850-48-1 Usage
Uses
Used in Organic Synthesis:
4-P-TOLYLSULFANYL-BUTYRIC ACID is used as a reactant in the preparation of alkyl N-heteroarenes via iridium photoredox catalyzed regioselective decarboxylative alkylation of N-heteroarenes with N-(acyloxy)phthalimides. This process allows for the selective formation of desired products with high efficiency and minimal side reactions, making it a valuable tool in the synthesis of complex organic molecules and pharmaceutical compounds.
Used in Pharmaceutical Industry:
4-P-TOLYLSULFANYL-BUTYRIC ACID is used as a key intermediate in the synthesis of various pharmaceutical compounds, particularly those with potential therapeutic applications. Its unique structure and reactivity enable the development of novel drug candidates with improved efficacy and selectivity, contributing to advancements in medicinal chemistry and drug discovery.
Used in Chemical Research:
4-P-TOLYLSULFANYL-BUTYRIC ACID serves as a valuable research tool in the field of organic chemistry, particularly in the study of reaction mechanisms, synthetic methodologies, and the development of new catalysts and reagents. Its unique properties and reactivity provide insights into the underlying principles of chemical reactions and help to expand the knowledge base of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 18850-48-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,8,5 and 0 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 18850-48:
(7*1)+(6*8)+(5*8)+(4*5)+(3*0)+(2*4)+(1*8)=131
131 % 10 = 1
So 18850-48-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H14O2S/c1-9-4-6-10(7-5-9)14-8-2-3-11(12)13/h4-7H,2-3,8H2,1H3,(H,12,13)
18850-48-1Relevant academic research and scientific papers
Synthesis of thioether andrographolide derivatives and their inhibitory effect against cancer cells
Liu, Yi,Liang, Ren-Ming,Ma, Qing-Ping,Xu, Kai,Liang, Xin-Yong,Huang, Wei,Sutton, Robert,Ding, Jie,O'Neil, Paul M.,Cheng, Chun-Ru
, p. 1268 - 1274 (2017/07/07)
A series of novel thioether andrographolide derivatives were synthesized by incorporating various aromatic (or heteroaromatic) substituents into C-12 or 14-OH. A total of 38 andrographolide derivatives were prepared and evaluated for their in vitro inhibi
NOVEL SUBSTITUTED ARYL DERIVATIVES, THEIR PROCESS OF PREPARATION AND THEIR THERAPEUTICAL USES AS ANTI-HIV AGENTS
-
Page/Page column 76, (2010/06/22)
The present invention concerns novel substituted aryl derivatives, their process of preparation and their use for inhibiting virus replication and for treating viral diseases or disorders such as HIV and/or HCV infection.
