18879-72-6 Usage
Uses
Used in Pharmaceutical Industry:
Benzothiazole, 6-ethoxy-2-methyl(7CI,8CI,9CI) is used as a bioactive compound for its potential pharmaceutical applications. Its unique molecular structure may contribute to the development of new drugs, particularly in the area of medicinal chemistry, where it could be utilized in the synthesis of therapeutic agents or as a scaffold for designing novel molecules with specific biological activities.
Used in Chemical Research:
In the field of chemical research, Benzothiazole, 6-ethoxy-2-methyl(7CI,8CI,9CI) serves as a valuable compound for studying the properties and reactivity of benzothiazole derivatives. Researchers may use Benzothiazole, 6-ethoxy-2-methyl- (7CI,8CI,9CI) to investigate its chemical behavior, interactions with other molecules, and potential applications in various chemical processes.
Used in Material Science:
Benzothiazole, 6-ethoxy-2-methyl(7CI,8CI,9CI) may also find applications in material science, where its unique structural features could be exploited to develop new materials with specific properties. For instance, it could be used in the synthesis of advanced polymers, coatings, or other materials with tailored characteristics for various industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 18879-72-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,8,7 and 9 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 18879-72:
(7*1)+(6*8)+(5*8)+(4*7)+(3*9)+(2*7)+(1*2)=166
166 % 10 = 6
So 18879-72-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NOS/c1-3-12-8-4-5-9-10(6-8)13-7(2)11-9/h4-6H,3H2,1-2H3
