18910-19-5 Usage
Uses
Used in Pharmaceutical and Medicinal Chemistry:
4-Acetyl-alfa-bromohydrocinnamic acid is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its presence of both bromine and acetyl groups makes it a valuable building block for the development of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Organic Synthesis:
4-Acetyl-alfa-bromohydrocinnamic acid is used as a reagent in organic synthesis for the preparation of a wide range of compounds. Its unique structure allows for various chemical reactions, making it a useful component in the creation of complex organic molecules.
Used in the Production of Fine Chemicals:
4-Acetyl-alfa-bromohydrocinnamic acid is utilized in the production of fine chemicals, which are high-purity chemicals used in various industries, including pharmaceuticals, agriculture, and materials science. Its versatility and reactivity contribute to the synthesis of specialty chemicals with specific applications.
Used in Chemical Research and Development:
4-Acetyl-alfa-bromohydrocinnamic acid serves as a valuable tool in chemical research and development. Its unique properties and reactivity make it an ideal candidate for exploring new synthetic pathways and developing innovative chemical processes. Researchers can leverage its bromine and acetyl groups to investigate novel reactions and mechanisms, potentially leading to the discovery of new compounds with unique properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 18910-19-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,9,1 and 0 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 18910-19:
(7*1)+(6*8)+(5*9)+(4*1)+(3*0)+(2*1)+(1*9)=115
115 % 10 = 5
So 18910-19-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H11BrO3/c1-7(13)9-4-2-8(3-5-9)6-10(12)11(14)15/h2-5,10H,6H2,1H3,(H,14,15)
