19786-56-2 Usage
General Description
4-HYDRAZINO-5-METHYLTHIENO[2,3-D]PYRIMIDINE is a chemical compound with the molecular formula C6H7N5S. It is a heterocyclic compound containing a thieno[2,3-d]pyrimidine ring system with a hydrazino group at the 4-position and a methyl group at the 5-position. 4-HYDRAZINO-5-METHYLTHIENO[2,3-D]PYRIMIDINE has potential applications in pharmaceutical and agrochemical industries due to its unique structure and potential biological activities. Its properties and potential uses make it an interesting target for further research and development in the field of medicinal and agricultural chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 19786-56-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,7,8 and 6 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 19786-56:
(7*1)+(6*9)+(5*7)+(4*8)+(3*6)+(2*5)+(1*6)=162
162 % 10 = 2
So 19786-56-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N4S/c1-4-2-12-7-5(4)6(11-8)9-3-10-7/h2-3H,8H2,1H3,(H,9,10,11)