20662-83-3 Usage
General Description
4,5-Dimethyloxazole is a chemical compound with the molecular formula C5H7NO. It is a five-membered heterocyclic compound containing an oxygen atom and a nitrogen atom in its structure. The compound has two methyl groups attached to the carbon atoms at positions 4 and 5. 4,5-Dimethyloxazole is commonly used as a building block in the synthesis of pharmaceuticals, agrochemicals, and natural products. It is also used in the production of polymers and as a solvent in various industrial processes. Additionally, 4,5-Dimethyloxazole is utilized as a precursor in the preparation of other organic compounds. Due to its versatile applications, this chemical compound is of significant interest in the fields of organic chemistry and chemical synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 20662-83-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,6,6 and 2 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 20662-83:
(7*2)+(6*0)+(5*6)+(4*6)+(3*2)+(2*8)+(1*3)=93
93 % 10 = 3
So 20662-83-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H7NO/c1-4-5(2)7-3-6-4/h3H,1-2H3
