20662-83-3 Usage
Uses
Used in Pharmaceutical Synthesis:
4,5-Dimethyloxazole is used as a building block for the synthesis of pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique structure allows for the creation of diverse medicinal compounds with potential health benefits.
Used in Agrochemical Production:
In the agrochemical industry, 4,5-Dimethyloxazole serves as a key component in the synthesis of various agrochemicals, such as pesticides and herbicides. Its incorporation enhances the effectiveness of these products in protecting crops and managing pests.
Used in Polymer Production:
4,5-Dimethyloxazole is utilized in the production of polymers, which are large molecules composed of repeating structural units. Its presence in polymers can improve their properties, such as strength, flexibility, and durability, making them suitable for various applications, including plastics, fibers, and coatings.
Used as a Solvent in Industrial Processes:
4,5-Dimethyloxazole also functions as a solvent in various industrial processes. Its ability to dissolve other substances makes it valuable in applications such as chemical reactions, extraction, and purification.
Used in Organic Compound Preparation:
4,5-Dimethyloxazole acts as a precursor in the preparation of other organic compounds, further expanding its utility in chemical synthesis. Its involvement in the synthesis of additional compounds highlights its importance in creating a wide array of chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 20662-83-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,6,6 and 2 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 20662-83:
(7*2)+(6*0)+(5*6)+(4*6)+(3*2)+(2*8)+(1*3)=93
93 % 10 = 3
So 20662-83-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H7NO/c1-4-5(2)7-3-6-4/h3H,1-2H3
