2134-76-1 Usage
Description
4-[(2-amino-4-oxo-7,8-dihydro-1H-pteridin-6-yl)methylamino]benzoic acid is a pteroic acid derivative that arises from the formal hydrogenation of the 7,8-double bond of pteroic acid. It is a complex organic compound with potential applications in various fields due to its unique chemical structure and properties.
Uses
Used in Pharmaceutical Industry:
4-[(2-amino-4-oxo-7,8-dihydro-1H-pteridin-6-yl)methylamino]benzoic acid is used as a pharmaceutical intermediate for the synthesis of various drugs and medications. Its unique chemical structure allows it to be a key component in the development of new therapeutic agents.
Used in Research and Development:
4-[(2-amino-4-oxo-7,8-dihydro-1H-pteridin-6-yl)methylamino]benzoic acid is also used in research and development settings to study its properties and potential applications. Scientists and researchers can use it to investigate its interactions with other molecules and its potential use in the development of new drugs and therapies.
Used in Diagnostic Applications:
4-[(2-amino-4-oxo-7,8-dihydro-1H-pteridin-6-yl)methylamino]benzoic acid can be used in diagnostic applications, such as in the development of assays and tests to detect specific biological markers or to study the mechanisms of certain diseases.
Used in Chemical Synthesis:
Due to its unique structure, 4-[(2-amino-4-oxo-7,8-dihydro-1H-pteridin-6-yl)methylamino]benzoic acid can be used as a building block in the synthesis of other complex organic compounds. This makes it a valuable resource in the field of organic chemistry and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 2134-76-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,3 and 4 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 2134-76:
(6*2)+(5*1)+(4*3)+(3*4)+(2*7)+(1*6)=61
61 % 10 = 1
So 2134-76-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H14N6O3/c15-14-19-11-10(12(21)20-14)18-9(6-17-11)5-16-8-3-1-7(2-4-8)13(22)23/h1-4,16H,5-6H2,(H,22,23)(H4,15,17,19,20,21)
2134-76-1Relevant articles and documents
Synthesis and analysis of bacterial folate metabolism intermediates and antifolates
Dawadi, Surendra,Kordus, Shannon L.,Baughn, Anthony D.,Aldrich, Courtney C.
, p. 5220 - 5223 (2017/11/06)
The mechanism of action of para-aminosalicylic acid (PAS), a drug used to treat drug-resistant tuberculosis (TB), has been confirmed through the first synthesis and biochemical characterization of its active metabolite 7. The synthesis features the coupling of N2-acetyl-6-formylpterin obtained from the degradation of folic acid and appropriately functionalized arylamines to form Schiff bases. The sequential chemoselective reduction of the imine and pterin ring led to the formation of dihydrofolate analogue 7 and two other dihydropteroate species.
Folate analogues. XVII. Synthesis of pteroic acid and 4-amino-4-deoxypteroic acid
Nair,Adapa,Bridges
, p. 3152 - 3155 (2007/10/02)
-